C21H22F2O4S — CID 163462179
(6aR,8R,10aS)-1,4-difluoro-8-methoxy-10a-(4-methylphenyl)sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene (PubChem CID 163462179) has the molecular formula C21H22F2O4S and a molecular weight of 408.47 g/mol. Its IUPAC name is (6aR,8R,10aS)-1,4-difluoro-8-methoxy-10a-(4-methylphenyl)sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene.
| Compound Name | (6aR,8R,10aS)-1,4-difluoro-8-methoxy-10a-(4-methylphenyl)sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 163462179 |
| Molecular Formula | C21H22F2O4S |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | (6aR,8R,10aS)-1,4-difluoro-8-methoxy-10a-(4-methylphenyl)sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
| SMILES | CO[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(C)cc3)c3c(F)ccc(F)c3OC[C@H]2C1 |
| InChI | InChI=1S/C21H22F2O4S/c1-13-3-5-16(6-4-13)28(24,25)21-10-9-15(26-2)11-14(21)12-27-20-18(23)8-7-17(22)19(20)21/h3-8,14-15H,9-12H2,1-2H3/t14-,15-,21+/m1/s1 |
| InChIKey | BPNUORLAUUHHHM-PZPWOCDFSA-N |
| XLogP | 4.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |