C22H21ClF2O4S — CID 67006734
10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-8-prop-2-enoxy-6,6a,7,8,9,10-hexahydrobenzo[c]chromene (PubChem CID 67006734) has the molecular formula C22H21ClF2O4S and a molecular weight of 454.92 g/mol. Its IUPAC name is 10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-8-prop-2-enoxy-6,6a,7,8,9,10-hexahydrobenzo[c]chromene.
| Compound Name | 10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-8-prop-2-enoxy-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 67006734 |
| Molecular Formula | C22H21ClF2O4S |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-8-prop-2-enoxy-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
| SMILES | C=CCOC1CCC2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OCC2C1 |
| InChI | InChI=1S/C22H21ClF2O4S/c1-2-11-28-16-9-10-22(30(26,27)17-5-3-15(23)4-6-17)14(12-16)13-29-21-19(25)8-7-18(24)20(21)22/h2-8,14,16H,1,9-13H2 |
| InChIKey | XILBJAXTMIXXBZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|