C22H25ClF2O4S — CID 143514164
[(10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]methanol;ethane (PubChem CID 143514164) has the molecular formula C22H25ClF2O4S and a molecular weight of 458.95 g/mol. Its IUPAC name is [(10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]methanol;ethane.
| Compound Name | [(10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]methanol;ethane |
|---|---|
| PubChem CID | 143514164 |
| Molecular Formula | C22H25ClF2O4S |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | [(10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]methanol;ethane |
| SMILES | CC.O=S(=O)(c1ccc(Cl)cc1)[C@@]12CCC(CO)CC1COc1c(F)ccc(F)c12 |
| InChI | InChI=1S/C20H19ClF2O4S.C2H6/c21-14-1-3-15(4-2-14)28(25,26)20-8-7-12(10-24)9-13(20)11-27-19-17(23)6-5-16(22)18(19)20;1-2/h1-6,12-13,24H,7-11H2;1-2H3/t12?,13?,20-;/m0./s1 |
| InChIKey | IPMBTZZWXQMQBX-ILVXPAERSA-N |
| XLogP | 5.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |