C18H15ClF2O3S2 — CID 58950079
(4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-thiopyrano[2,3-c]chromene (PubChem CID 58950079) has the molecular formula C18H15ClF2O3S2 and a molecular weight of 416.90 g/mol. Its IUPAC name is (4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-thiopyrano[2,3-c]chromene.
| Compound Name | (4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-thiopyrano[2,3-c]chromene |
|---|---|
| PubChem CID | 58950079 |
| Molecular Formula | C18H15ClF2O3S2 |
| Molecular Weight | 416.90 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | (4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,3,4a,5-tetrahydro-1H-thiopyrano[2,3-c]chromene |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)[C@]12CCCS[C@H]1COc1c(F)ccc(F)c12 |
| InChI | InChI=1S/C18H15ClF2O3S2/c19-11-2-4-12(5-3-11)26(22,23)18-8-1-9-25-15(18)10-24-17-14(21)7-6-13(20)16(17)18/h2-7,15H,1,8-10H2/t15-,18+/m0/s1 |
| InChIKey | SPSYUFPAQUECLN-MAUKXSAKSA-N |
| XLogP | 4.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.90 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |