C25H30ClF2NO6S — CID 143513912
(10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene;ethyl-[(2R)-2-hydroxypropyl]carbamic acid (PubChem CID 143513912) has the molecular formula C25H30ClF2NO6S and a molecular weight of 546.03 g/mol. Its IUPAC name is (10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene;ethyl-[(2R)-2-hydroxypropyl]carbamic acid.
| Compound Name | (10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene;ethyl-[(2R)-2-hydroxypropyl]carbamic acid |
|---|---|
| PubChem CID | 143513912 |
| Molecular Formula | C25H30ClF2NO6S |
| Molecular Weight | 546.03 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | (10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene;ethyl-[(2R)-2-hydroxypropyl]carbamic acid |
| SMILES | CCN(C[C@@H](C)O)C(=O)O.O=S(=O)(c1ccc(Cl)cc1)[C@@]12CCCCC1COc1c(F)ccc(F)c12 |
| InChI | InChI=1S/C19H17ClF2O3S.C6H13NO3/c20-13-4-6-14(7-5-13)26(23,24)19-10-2-1-3-12(19)11-25-18-16(22)9-8-15(21)17(18)19;1-3-7(6(9)10)4-5(2)8/h4-9,12H,1-3,10-11H2;5,8H,3-4H2,1-2H3,(H,9,10)/t12?,19-;5-/m01/s1 |
| InChIKey | URSWKPPKXPRZOE-SDXPWJNUSA-N |
| XLogP | 5.24 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.03 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |