C23H22ClF2NO7S2 — CID 58252259
2-[(1R,2S,4S,7R,10S)-10-(4-chlorophenyl)sulfonyl-12,15-difluoro-5,5-dioxo-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-trien-4-yl]acetic acid (PubChem CID 58252259) has the molecular formula C23H22ClF2NO7S2 and a molecular weight of 562.01 g/mol. Its IUPAC name is 2-[(1R,2S,4S,7R,10S)-10-(4-chlorophenyl)sulfonyl-12,15-difluoro-5,5-dioxo-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-trien-4-yl]acetic acid.
| Compound Name | 2-[(1R,2S,4S,7R,10S)-10-(4-chlorophenyl)sulfonyl-12,15-difluoro-5,5-dioxo-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-trien-4-yl]acetic acid |
|---|---|
| PubChem CID | 58252259 |
| Molecular Formula | C23H22ClF2NO7S2 |
| Molecular Weight | 562.01 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | 2-[(1R,2S,4S,7R,10S)-10-(4-chlorophenyl)sulfonyl-12,15-difluoro-5,5-dioxo-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-trien-4-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1C[C@@H]2[C@@H](CC[C@@]3(S(=O)(=O)c4ccc(Cl)cc4)c4c(F)ccc(F)c4OC[C@@H]23)NS1(=O)=O |
| InChI | InChI=1S/C23H22ClF2NO7S2/c24-12-1-3-13(4-2-12)35(30,31)23-8-7-19-15(9-14(10-20(28)29)36(32,33)27-19)16(23)11-34-22-18(26)6-5-17(25)21(22)23/h1-6,14-16,19,27H,7-11H2,(H,28,29)/t14-,15-,16-,19+,23-/m0/s1 |
| InChIKey | VRXRRDCAONGCJF-SOHUWHGYSA-N |
| XLogP | 3.24 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.01 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |