C17H24ClFN2O3 — CID 159413930
tert-butyl 1,4-diazepane-1-carboxylate;3-chloro-2-fluorobenzaldehyde (PubChem CID 159413930) has the molecular formula C17H24ClFN2O3 and a molecular weight of 358.84 g/mol. Its IUPAC name is tert-butyl 1,4-diazepane-1-carboxylate;3-chloro-2-fluorobenzaldehyde.
| Compound Name | tert-butyl 1,4-diazepane-1-carboxylate;3-chloro-2-fluorobenzaldehyde |
|---|---|
| PubChem CID | 159413930 |
| Molecular Formula | C17H24ClFN2O3 |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | tert-butyl 1,4-diazepane-1-carboxylate;3-chloro-2-fluorobenzaldehyde |
| SMILES | CC(C)(C)OC(=O)N1CCCNCC1.O=Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C10H20N2O2.C7H4ClFO/c1-10(2,3)14-9(13)12-7-4-5-11-6-8-12;8-6-3-1-2-5(4-10)7(6)9/h11H,4-8H2,1-3H3;1-4H |
| InChIKey | LOXQXPUCCQXGOL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|