About 3-phenylpropanethioic S-acid;3-phenyl-1-sulfonylpropan-1-ol
3-phenylpropanethioic S-acid;3-phenyl-1-sulfonylpropan-1-ol (PubChem CID 159424009) has the molecular formula C18H20O4S2
and a molecular weight of 364.49 g/mol. Its IUPAC name is 3-phenylpropanethioic S-acid;3-phenyl-1-sulfonylpropan-1-ol.
Molecular Properties
| Compound Name | 3-phenylpropanethioic S-acid;3-phenyl-1-sulfonylpropan-1-ol |
| PubChem CID | 159424009 |
| Molecular Formula | C18H20O4S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 3-phenylpropanethioic S-acid;3-phenyl-1-sulfonylpropan-1-ol |
| SMILES | O=C(S)CCc1ccccc1.O=S(=O)=C(O)CCc1ccccc1 |
| InChI | InChI=1S/C9H10O3S.C9H10OS/c10-9(13(11)12)7-6-8-4-2-1-3-5-8;10-9(11)7-6-8-4-2-1-3-5-8/h1-5,10H,6-7H2;1-5H,6-7H2,(H,10,11) |
| InChIKey | LQCQNEKQALWPGO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpropanethioic S-acid;3-phenyl-1-sulfonylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropanethioic S-acid;3-phenyl-1-sulfonylpropan-1-ol?
The IUPAC name of 3-phenylpropanethioic S-acid;3-phenyl-1-sulfonylpropan-1-ol (CID 159424009) is 3-phenylpropanethioic S-acid;3-phenyl-1-sulfonylpropan-1-ol.
What is the SMILES notation for 3-phenylpropanethioic S-acid;3-phenyl-1-sulfonylpropan-1-ol?
The canonical SMILES for 3-phenylpropanethioic S-acid;3-phenyl-1-sulfonylpropan-1-ol is O=C(S)CCc1ccccc1.O=S(=O)=C(O)CCc1ccccc1.
What is the InChIKey of 3-phenylpropanethioic S-acid;3-phenyl-1-sulfonylpropan-1-ol?
The InChIKey is LQCQNEKQALWPGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3S.C9H10OS/c10-9(13(11)12)7-6-8-4-2-1-3-5-8;10-9(11)7-6-8-4-2-1-3-5-8/h1-5,10H,6-7H2;1-5H,6-7H2,(H,10,11).
What are the key properties of 3-phenylpropanethioic S-acid;3-phenyl-1-sulfonylpropan-1-ol?
3-phenylpropanethioic S-acid;3-phenyl-1-sulfonylpropan-1-ol has a molecular weight of 364.49 g/mol, XLogP of 3.26, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropanethioic S-acid;3-phenyl-1-sulfonylpropan-1-ol is sourced from PubChem (CID 159424009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).