About dimethoxy(dimethyl)silane;dimethoxy(methyl)silane;trimethoxy(methyl)silane
dimethoxy(dimethyl)silane;dimethoxy(methyl)silane;trimethoxy(methyl)silane (PubChem CID 159426131) has the molecular formula C11H34O7Si3
and a molecular weight of 362.64 g/mol. Its IUPAC name is dimethoxy(dimethyl)silane;dimethoxy(methyl)silane;trimethoxy(methyl)silane.
Molecular Properties
| Compound Name | dimethoxy(dimethyl)silane;dimethoxy(methyl)silane;trimethoxy(methyl)silane |
| PubChem CID | 159426131 |
| Molecular Formula | C11H34O7Si3 |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | dimethoxy(dimethyl)silane;dimethoxy(methyl)silane;trimethoxy(methyl)silane |
| SMILES | CO[SiH](C)OC.CO[Si](C)(C)OC.CO[Si](C)(OC)OC |
| InChI | InChI=1S/C4H12O3Si.C4H12O2Si.C3H10O2Si/c1-5-8(4,6-2)7-3;1-5-7(3,4)6-2;1-4-6(3)5-2/h1-4H3;1-4H3;6H,1-3H3 |
| InChIKey | LQJJQEYHYKVYBN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(dimethyl)silane;dimethoxy(methyl)silane;trimethoxy(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(dimethyl)silane;dimethoxy(methyl)silane;trimethoxy(methyl)silane?
The IUPAC name of dimethoxy(dimethyl)silane;dimethoxy(methyl)silane;trimethoxy(methyl)silane (CID 159426131) is dimethoxy(dimethyl)silane;dimethoxy(methyl)silane;trimethoxy(methyl)silane.
What is the SMILES notation for dimethoxy(dimethyl)silane;dimethoxy(methyl)silane;trimethoxy(methyl)silane?
The canonical SMILES for dimethoxy(dimethyl)silane;dimethoxy(methyl)silane;trimethoxy(methyl)silane is CO[SiH](C)OC.CO[Si](C)(C)OC.CO[Si](C)(OC)OC.
What is the InChIKey of dimethoxy(dimethyl)silane;dimethoxy(methyl)silane;trimethoxy(methyl)silane?
The InChIKey is LQJJQEYHYKVYBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12O3Si.C4H12O2Si.C3H10O2Si/c1-5-8(4,6-2)7-3;1-5-7(3,4)6-2;1-4-6(3)5-2/h1-4H3;1-4H3;6H,1-3H3.
What are the key properties of dimethoxy(dimethyl)silane;dimethoxy(methyl)silane;trimethoxy(methyl)silane?
dimethoxy(dimethyl)silane;dimethoxy(methyl)silane;trimethoxy(methyl)silane has a molecular weight of 362.64 g/mol, XLogP of 1.60, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(dimethyl)silane;dimethoxy(methyl)silane;trimethoxy(methyl)silane is sourced from PubChem (CID 159426131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).