About dimethoxy(methyl)silane;hydroxysilane
dimethoxy(methyl)silane;hydroxysilane (PubChem CID 161377530) has the molecular formula C3H14O3Si2
and a molecular weight of 154.31 g/mol. Its IUPAC name is dimethoxy(methyl)silane;hydroxysilane.
Molecular Properties
| Compound Name | dimethoxy(methyl)silane;hydroxysilane |
| PubChem CID | 161377530 |
| Molecular Formula | C3H14O3Si2 |
| Molecular Weight | 154.31 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | dimethoxy(methyl)silane;hydroxysilane |
| SMILES | CO[SiH](C)OC.O[SiH3] |
| InChI | InChI=1S/C3H10O2Si.H4OSi/c1-4-6(3)5-2;1-2/h6H,1-3H3;1H,2H3 |
| InChIKey | VRGRNEAEZNKDMZ-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.31 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(methyl)silane;hydroxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(methyl)silane;hydroxysilane?
The IUPAC name of dimethoxy(methyl)silane;hydroxysilane (CID 161377530) is dimethoxy(methyl)silane;hydroxysilane.
What is the SMILES notation for dimethoxy(methyl)silane;hydroxysilane?
The canonical SMILES for dimethoxy(methyl)silane;hydroxysilane is CO[SiH](C)OC.O[SiH3].
What is the InChIKey of dimethoxy(methyl)silane;hydroxysilane?
The InChIKey is VRGRNEAEZNKDMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O2Si.H4OSi/c1-4-6(3)5-2;1-2/h6H,1-3H3;1H,2H3.
What are the key properties of dimethoxy(methyl)silane;hydroxysilane?
dimethoxy(methyl)silane;hydroxysilane has a molecular weight of 154.31 g/mol, XLogP of -1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(methyl)silane;hydroxysilane is sourced from PubChem (CID 161377530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).