About dimethoxy(methyl)silane;N-methylmethanamine
dimethoxy(methyl)silane;N-methylmethanamine (PubChem CID 173466021) has the molecular formula C5H17NO2Si
and a molecular weight of 151.28 g/mol. Its IUPAC name is dimethoxy(methyl)silane;N-methylmethanamine.
Molecular Properties
| Compound Name | dimethoxy(methyl)silane;N-methylmethanamine |
| PubChem CID | 173466021 |
| Molecular Formula | C5H17NO2Si |
| Molecular Weight | 151.28 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | dimethoxy(methyl)silane;N-methylmethanamine |
| SMILES | CNC.CO[SiH](C)OC |
| InChI | InChI=1S/C3H10O2Si.C2H7N/c1-4-6(3)5-2;1-3-2/h6H,1-3H3;3H,1-2H3 |
| InChIKey | YEECBDWRFMFNSP-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(methyl)silane;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(methyl)silane;N-methylmethanamine?
The IUPAC name of dimethoxy(methyl)silane;N-methylmethanamine (CID 173466021) is dimethoxy(methyl)silane;N-methylmethanamine.
What is the SMILES notation for dimethoxy(methyl)silane;N-methylmethanamine?
The canonical SMILES for dimethoxy(methyl)silane;N-methylmethanamine is CNC.CO[SiH](C)OC.
What is the InChIKey of dimethoxy(methyl)silane;N-methylmethanamine?
The InChIKey is YEECBDWRFMFNSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O2Si.C2H7N/c1-4-6(3)5-2;1-3-2/h6H,1-3H3;3H,1-2H3.
What are the key properties of dimethoxy(methyl)silane;N-methylmethanamine?
dimethoxy(methyl)silane;N-methylmethanamine has a molecular weight of 151.28 g/mol, XLogP of -0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(methyl)silane;N-methylmethanamine is sourced from PubChem (CID 173466021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).