About 1H-indole;methyl 3-indol-1-yl-3-phenylpropanoate;methyl (E)-3-phenylprop-2-enoate
1H-indole;methyl 3-indol-1-yl-3-phenylpropanoate;methyl (E)-3-phenylprop-2-enoate (PubChem CID 159439369) has the molecular formula C36H34N2O4
and a molecular weight of 558.68 g/mol. Its IUPAC name is 1H-indole;methyl 3-indol-1-yl-3-phenylpropanoate;methyl (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 1H-indole;methyl 3-indol-1-yl-3-phenylpropanoate;methyl (E)-3-phenylprop-2-enoate |
| PubChem CID | 159439369 |
| Molecular Formula | C36H34N2O4 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 1H-indole;methyl 3-indol-1-yl-3-phenylpropanoate;methyl (E)-3-phenylprop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccccc1.COC(=O)CC(c1ccccc1)n1ccc2ccccc21.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C18H17NO2.C10H10O2.C8H7N/c1-21-18(20)13-17(14-7-3-2-4-8-14)19-12-11-15-9-5-6-10-16(15)19;1-12-10(11)8-7-9-5-3-2-4-6-9;1-2-4-8-7(3-1)5-6-9-8/h2-12,17H,13H2,1H3;2-8H,1H3;1-6,9H/b;8-7+; |
| InChIKey | LRZAAYGGIWREQR-BVUSFOFSSA-N |
| XLogP | 7.83 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole;methyl 3-indol-1-yl-3-phenylpropanoate;methyl (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole;methyl 3-indol-1-yl-3-phenylpropanoate;methyl (E)-3-phenylprop-2-enoate?
The IUPAC name of 1H-indole;methyl 3-indol-1-yl-3-phenylpropanoate;methyl (E)-3-phenylprop-2-enoate (CID 159439369) is 1H-indole;methyl 3-indol-1-yl-3-phenylpropanoate;methyl (E)-3-phenylprop-2-enoate.
What is the SMILES notation for 1H-indole;methyl 3-indol-1-yl-3-phenylpropanoate;methyl (E)-3-phenylprop-2-enoate?
The canonical SMILES for 1H-indole;methyl 3-indol-1-yl-3-phenylpropanoate;methyl (E)-3-phenylprop-2-enoate is COC(=O)/C=C/c1ccccc1.COC(=O)CC(c1ccccc1)n1ccc2ccccc21.c1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indole;methyl 3-indol-1-yl-3-phenylpropanoate;methyl (E)-3-phenylprop-2-enoate?
The InChIKey is LRZAAYGGIWREQR-BVUSFOFSSA-N. The full InChI is InChI=1S/C18H17NO2.C10H10O2.C8H7N/c1-21-18(20)13-17(14-7-3-2-4-8-14)19-12-11-15-9-5-6-10-16(15)19;1-12-10(11)8-7-9-5-3-2-4-6-9;1-2-4-8-7(3-1)5-6-9-8/h2-12,17H,13H2,1H3;2-8H,1H3;1-6,9H/b;8-7+;.
What are the key properties of 1H-indole;methyl 3-indol-1-yl-3-phenylpropanoate;methyl (E)-3-phenylprop-2-enoate?
1H-indole;methyl 3-indol-1-yl-3-phenylpropanoate;methyl (E)-3-phenylprop-2-enoate has a molecular weight of 558.68 g/mol, XLogP of 7.83, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole;methyl 3-indol-1-yl-3-phenylpropanoate;methyl (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 159439369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).