C23H35N2O15P — CID 159450605
(2S)-2-[[(1S)-1-carboxy-2-(4-hydroxy-3-methylphenyl)ethyl]carbamoylamino]pentanedioic acid;methane;2-(phosphonomethyl)pentanedioic acid (PubChem CID 159450605) has the molecular formula C23H35N2O15P and a molecular weight of 610.51 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-2-(4-hydroxy-3-methylphenyl)ethyl]carbamoylamino]pentanedioic acid;methane;2-(phosphonomethyl)pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-2-(4-hydroxy-3-methylphenyl)ethyl]carbamoylamino]pentanedioic acid;methane;2-(phosphonomethyl)pentanedioic acid |
|---|---|
| PubChem CID | 159450605 |
| Molecular Formula | C23H35N2O15P |
| Molecular Weight | 610.51 g/mol |
| Exact Mass | 610.18 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-2-(4-hydroxy-3-methylphenyl)ethyl]carbamoylamino]pentanedioic acid;methane;2-(phosphonomethyl)pentanedioic acid |
| SMILES | C.Cc1cc(C[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)ccc1O.O=C(O)CCC(CP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C16H20N2O8.C6H11O7P.CH4/c1-8-6-9(2-4-12(8)19)7-11(15(24)25)18-16(26)17-10(14(22)23)3-5-13(20)21;7-5(8)2-1-4(6(9)10)3-14(11,12)13;/h2,4,6,10-11,19H,3,5,7H2,1H3,(H,20,21)(H,22,23)(H,24,25)(H2,17,18,26);4H,1-3H2,(H,7,8)(H,9,10)(H2,11,12,13);1H4/t10-,11-;;/m0../s1 |
| InChIKey | LTIAWTOSKSPGIE-ULEGLUPFSA-N |
| XLogP | 0.68 |
| TPSA | 305.39 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.51 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|