About 3-phenyl-4H-quinazoline;hydrochloride
3-phenyl-4H-quinazoline;hydrochloride (PubChem CID 15945624) has the molecular formula C14H13ClN2
and a molecular weight of 244.73 g/mol. Its IUPAC name is 3-phenyl-4H-quinazoline;hydrochloride.
Molecular Properties
| Compound Name | 3-phenyl-4H-quinazoline;hydrochloride |
| PubChem CID | 15945624 |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.73 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-phenyl-4H-quinazoline;hydrochloride |
| SMILES | C1=Nc2ccccc2CN1c1ccccc1.Cl |
| InChI | InChI=1S/C14H12N2.ClH/c1-2-7-13(8-3-1)16-10-12-6-4-5-9-14(12)15-11-16;/h1-9,11H,10H2;1H |
| InChIKey | SSYYHLNEVQGLNV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.73 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-4H-quinazoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-4H-quinazoline;hydrochloride?
The IUPAC name of 3-phenyl-4H-quinazoline;hydrochloride (CID 15945624) is 3-phenyl-4H-quinazoline;hydrochloride.
What is the SMILES notation for 3-phenyl-4H-quinazoline;hydrochloride?
The canonical SMILES for 3-phenyl-4H-quinazoline;hydrochloride is C1=Nc2ccccc2CN1c1ccccc1.Cl.
What is the InChIKey of 3-phenyl-4H-quinazoline;hydrochloride?
The InChIKey is SSYYHLNEVQGLNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2.ClH/c1-2-7-13(8-3-1)16-10-12-6-4-5-9-14(12)15-11-16;/h1-9,11H,10H2;1H.
What are the key properties of 3-phenyl-4H-quinazoline;hydrochloride?
3-phenyl-4H-quinazoline;hydrochloride has a molecular weight of 244.73 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-4H-quinazoline;hydrochloride is sourced from PubChem (CID 15945624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).