C15H26OS — CID 159459669
2-[1-[(R)-tert-butylsulfinyl]pentan-2-yl]cyclohexa-1,3-diene (PubChem CID 159459669) has the molecular formula C15H26OS and a molecular weight of 254.44 g/mol. Its IUPAC name is 2-[1-[(R)-tert-butylsulfinyl]pentan-2-yl]cyclohexa-1,3-diene.
| Compound Name | 2-[1-[(R)-tert-butylsulfinyl]pentan-2-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 159459669 |
| Molecular Formula | C15H26OS |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2-[1-[(R)-tert-butylsulfinyl]pentan-2-yl]cyclohexa-1,3-diene |
| SMILES | CCCC(C[S@@](=O)C(C)(C)C)C1=CCCC=C1 |
| InChI | InChI=1S/C15H26OS/c1-5-9-14(12-17(16)15(2,3)4)13-10-7-6-8-11-13/h7,10-11,14H,5-6,8-9,12H2,1-4H3/t14?,17-/m1/s1 |
| InChIKey | LUKVVVYEWQNXFC-FBMWCMRBSA-N |
| XLogP | 4.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |