C28H52O3Si2 — CID 159467371
[(2R,3R)-3-[2-tri(propan-2-yl)silylethynyl]oxiran-2-yl]methanol;(E)-5-tri(propan-2-yl)silylpent-2-en-4-yn-1-ol (PubChem CID 159467371) has the molecular formula C28H52O3Si2 and a molecular weight of 492.89 g/mol. Its IUPAC name is [(2R,3R)-3-[2-tri(propan-2-yl)silylethynyl]oxiran-2-yl]methanol;(E)-5-tri(propan-2-yl)silylpent-2-en-4-yn-1-ol.
| Compound Name | [(2R,3R)-3-[2-tri(propan-2-yl)silylethynyl]oxiran-2-yl]methanol;(E)-5-tri(propan-2-yl)silylpent-2-en-4-yn-1-ol |
|---|---|
| PubChem CID | 159467371 |
| Molecular Formula | C28H52O3Si2 |
| Molecular Weight | 492.89 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | [(2R,3R)-3-[2-tri(propan-2-yl)silylethynyl]oxiran-2-yl]methanol;(E)-5-tri(propan-2-yl)silylpent-2-en-4-yn-1-ol |
| SMILES | CC(C)[Si](C#C/C=C/CO)(C(C)C)C(C)C.CC(C)[Si](C#C[C@H]1O[C@@H]1CO)(C(C)C)C(C)C |
| InChI | InChI=1S/C14H26O2Si.C14H26OSi/c1-10(2)17(11(3)4,12(5)6)8-7-13-14(9-15)16-13;1-12(2)16(13(3)4,14(5)6)11-9-7-8-10-15/h10-15H,9H2,1-6H3;7-8,12-15H,10H2,1-6H3/b;8-7+/t13-,14-;/m1./s1 |
| InChIKey | LVIZDYXBSHYEGB-FLRWRBDUSA-N |
| XLogP | 6.72 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.89 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|