C22H44O3Si2 — CID 90365497
[(2S,3S,4S,5S,6R)-3,4-dimethyl-6-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silyloxyoxan-2-yl]methanol (PubChem CID 90365497) has the molecular formula C22H44O3Si2 and a molecular weight of 412.76 g/mol. Its IUPAC name is [(2S,3S,4S,5S,6R)-3,4-dimethyl-6-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silyloxyoxan-2-yl]methanol.
| Compound Name | [(2S,3S,4S,5S,6R)-3,4-dimethyl-6-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silyloxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 90365497 |
| Molecular Formula | C22H44O3Si2 |
| Molecular Weight | 412.76 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | [(2S,3S,4S,5S,6R)-3,4-dimethyl-6-(2-trimethylsilylethynyl)-5-tri(propan-2-yl)silyloxyoxan-2-yl]methanol |
| SMILES | CC(C)[Si](O[C@H]1[C@@H](C)[C@H](C)[C@@H](CO)O[C@@H]1C#C[Si](C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H44O3Si2/c1-15(2)27(16(3)4,17(5)6)25-22-19(8)18(7)21(14-23)24-20(22)12-13-26(9,10)11/h15-23H,14H2,1-11H3/t18-,19-,20+,21+,22-/m0/s1 |
| InChIKey | MPLNTWFOUPKSLK-ITBHCLRTSA-N |
| XLogP | 5.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.76 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|