C27H35N4O9+ — CID 159481554
2-[3-(1H-imidazol-3-ium-3-yl)propylcarbamoylamino]ethyl 2-methylprop-2-enoate;2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]benzoic acid (PubChem CID 159481554) has the molecular formula C27H35N4O9+ and a molecular weight of 559.60 g/mol. Its IUPAC name is 2-[3-(1H-imidazol-3-ium-3-yl)propylcarbamoylamino]ethyl 2-methylprop-2-enoate;2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]benzoic acid.
| Compound Name | 2-[3-(1H-imidazol-3-ium-3-yl)propylcarbamoylamino]ethyl 2-methylprop-2-enoate;2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 159481554 |
| Molecular Formula | C27H35N4O9+ |
| Molecular Weight | 559.60 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | 2-[3-(1H-imidazol-3-ium-3-yl)propylcarbamoylamino]ethyl 2-methylprop-2-enoate;2-[2-(2-methylprop-2-enoyloxy)ethoxycarbonyl]benzoic acid |
| SMILES | C=C(C)C(=O)OCCNC(=O)NCCC[n+]1cc[nH]c1.C=C(C)C(=O)OCCOC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C14H14O6.C13H20N4O3/c1-9(2)13(17)19-7-8-20-14(18)11-6-4-3-5-10(11)12(15)16;1-11(2)12(18)20-9-6-16-13(19)15-4-3-7-17-8-5-14-10-17/h3-6H,1,7-8H2,2H3,(H,15,16);5,8,10H,1,3-4,6-7,9H2,2H3,(H2,15,16,19)/p+1 |
| InChIKey | BYOPYBCWYSUTPF-UHFFFAOYSA-O |
| XLogP | 1.77 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.60 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|