C24H25ClN4O3S — CID 159494030
N-[6-[4-(4-chloro-2-methylphenoxy)butanoylamino]-5,6,7,8-tetrahydroquinazolin-2-yl]thiophene-2-carboxamide (PubChem CID 159494030) has the molecular formula C24H25ClN4O3S and a molecular weight of 485.01 g/mol. Its IUPAC name is N-[6-[4-(4-chloro-2-methylphenoxy)butanoylamino]-5,6,7,8-tetrahydroquinazolin-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[6-[4-(4-chloro-2-methylphenoxy)butanoylamino]-5,6,7,8-tetrahydroquinazolin-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 159494030 |
| Molecular Formula | C24H25ClN4O3S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | N-[6-[4-(4-chloro-2-methylphenoxy)butanoylamino]-5,6,7,8-tetrahydroquinazolin-2-yl]thiophene-2-carboxamide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)NC1CCc2nc(NC(=O)c3cccs3)ncc2C1 |
| InChI | InChI=1S/C24H25ClN4O3S/c1-15-12-17(25)6-9-20(15)32-10-2-5-22(30)27-18-7-8-19-16(13-18)14-26-24(28-19)29-23(31)21-4-3-11-33-21/h3-4,6,9,11-12,14,18H,2,5,7-8,10,13H2,1H3,(H,27,30)(H,26,28,29,31) |
| InChIKey | LYNZPCHLUXOFMR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|