C30H41F15O9S — CID 159520766
3-[2-[3-(2,2-dimethylbutanoyloxy)-2-hydroxypropoxy]-2-oxoethyl]sulfanyl-2-methylpropanoic acid;3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl 2,2-dimethylbutanoate (PubChem CID 159520766) has the molecular formula C30H41F15O9S and a molecular weight of 862.69 g/mol. Its IUPAC name is 3-[2-[3-(2,2-dimethylbutanoyloxy)-2-hydroxypropoxy]-2-oxoethyl]sulfanyl-2-methylpropanoic acid;3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl 2,2-dimethylbutanoate.
| Compound Name | 3-[2-[3-(2,2-dimethylbutanoyloxy)-2-hydroxypropoxy]-2-oxoethyl]sulfanyl-2-methylpropanoic acid;3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 159520766 |
| Molecular Formula | C30H41F15O9S |
| Molecular Weight | 862.69 g/mol |
| Exact Mass | 862.22 |
| IUPAC Name | 3-[2-[3-(2,2-dimethylbutanoyloxy)-2-hydroxypropoxy]-2-oxoethyl]sulfanyl-2-methylpropanoic acid;3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(O)COC(=O)CSCC(C)C(=O)O.CCC(C)(C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H15F15O2.C15H26O7S/c1-4-8(2,3)7(31)32-6-5-9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)30;1-5-15(3,4)14(20)22-7-11(16)6-21-12(17)9-23-8-10(2)13(18)19/h4-6H2,1-3H3;10-11,16H,5-9H2,1-4H3,(H,18,19) |
| InChIKey | MBTOGZPYWPRUQM-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.69 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|