C30H43F13O9S — CID 123157562
[4,4,5,5,6,6,7,7,8,8-decafluoro-3-(trifluoromethyl)octyl] 2,2-dimethylbutanoate;3-[2-[3-(2,2-dimethylbutanoyloxy)-2-hydroxypropoxy]-2-oxoethyl]sulfanyl-2-methylpropanoic acid (PubChem CID 123157562) has the molecular formula C30H43F13O9S and a molecular weight of 826.71 g/mol. Its IUPAC name is [4,4,5,5,6,6,7,7,8,8-decafluoro-3-(trifluoromethyl)octyl] 2,2-dimethylbutanoate;3-[2-[3-(2,2-dimethylbutanoyloxy)-2-hydroxypropoxy]-2-oxoethyl]sulfanyl-2-methylpropanoic acid.
| Compound Name | [4,4,5,5,6,6,7,7,8,8-decafluoro-3-(trifluoromethyl)octyl] 2,2-dimethylbutanoate;3-[2-[3-(2,2-dimethylbutanoyloxy)-2-hydroxypropoxy]-2-oxoethyl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 123157562 |
| Molecular Formula | C30H43F13O9S |
| Molecular Weight | 826.71 g/mol |
| Exact Mass | 826.24 |
| IUPAC Name | [4,4,5,5,6,6,7,7,8,8-decafluoro-3-(trifluoromethyl)octyl] 2,2-dimethylbutanoate;3-[2-[3-(2,2-dimethylbutanoyloxy)-2-hydroxypropoxy]-2-oxoethyl]sulfanyl-2-methylpropanoic acid |
| SMILES | CCC(C)(C)C(=O)OCC(O)COC(=O)CSCC(C)C(=O)O.CCC(C)(C)C(=O)OCCC(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H17F13O2.C15H26O7S/c1-4-10(2,3)9(29)30-6-5-7(13(22,23)24)11(18,19)14(25,26)15(27,28)12(20,21)8(16)17;1-5-15(3,4)14(20)22-7-11(16)6-21-12(17)9-23-8-10(2)13(18)19/h7-8H,4-6H2,1-3H3;10-11,16H,5-9H2,1-4H3,(H,18,19) |
| InChIKey | AKTGPAJNJVAYCI-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.71 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|