C27H39F11O9S — CID 91487338
1-O-[4,4,5,5,6,6-hexafluoro-3-(trifluoromethyl)hexyl] 5-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 2-ethyl-2,4,4-trimethylpentanedioate;molecular fluorine (PubChem CID 91487338) has the molecular formula C27H39F11O9S and a molecular weight of 748.64 g/mol. Its IUPAC name is 1-O-[4,4,5,5,6,6-hexafluoro-3-(trifluoromethyl)hexyl] 5-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 2-ethyl-2,4,4-trimethylpentanedioate;molecular fluorine.
| Compound Name | 1-O-[4,4,5,5,6,6-hexafluoro-3-(trifluoromethyl)hexyl] 5-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 2-ethyl-2,4,4-trimethylpentanedioate;molecular fluorine |
|---|---|
| PubChem CID | 91487338 |
| Molecular Formula | C27H39F11O9S |
| Molecular Weight | 748.64 g/mol |
| Exact Mass | 748.21 |
| IUPAC Name | 1-O-[4,4,5,5,6,6-hexafluoro-3-(trifluoromethyl)hexyl] 5-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 2-ethyl-2,4,4-trimethylpentanedioate;molecular fluorine |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCC(O)COC(=O)CSCC(C)C(=O)OC)C(=O)OCCC(C(F)(F)F)C(F)(F)C(F)(F)C(F)F.FF |
| InChI | InChI=1S/C27H39F9O9S.F2/c1-7-24(5,22(41)43-9-8-17(27(34,35)36)25(30,31)26(32,33)20(28)29)14-23(3,4)21(40)45-11-16(37)10-44-18(38)13-46-12-15(2)19(39)42-6;1-2/h15-17,20,37H,7-14H2,1-6H3; |
| InChIKey | CKBRQXCMMQNAMN-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.64 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|