C41H46O7 — CID 15953551
methyl 2-methoxy-6-[(E,4R)-4-phenylmethoxy-5-[(2S,4R,6S)-2-phenyl-6-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl]pent-1-enyl]benzoate (PubChem CID 15953551) has the molecular formula C41H46O7 and a molecular weight of 650.81 g/mol. Its IUPAC name is methyl 2-methoxy-6-[(E,4R)-4-phenylmethoxy-5-[(2S,4R,6S)-2-phenyl-6-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl]pent-1-enyl]benzoate.
| Compound Name | methyl 2-methoxy-6-[(E,4R)-4-phenylmethoxy-5-[(2S,4R,6S)-2-phenyl-6-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl]pent-1-enyl]benzoate |
|---|---|
| PubChem CID | 15953551 |
| Molecular Formula | C41H46O7 |
| Molecular Weight | 650.81 g/mol |
| Exact Mass | 650.32 |
| IUPAC Name | methyl 2-methoxy-6-[(E,4R)-4-phenylmethoxy-5-[(2S,4R,6S)-2-phenyl-6-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl]pent-1-enyl]benzoate |
| SMILES | COC(=O)c1c(/C=C/C[C@H](C[C@@H]2C[C@H](CCCOCc3ccccc3)O[C@H](c3ccccc3)O2)OCc2ccccc2)cccc1OC |
| InChI | InChI=1S/C41H46O7/c1-43-38-25-13-22-33(39(38)40(42)44-2)21-12-23-35(46-30-32-17-8-4-9-18-32)27-37-28-36(47-41(48-37)34-19-10-5-11-20-34)24-14-26-45-29-31-15-6-3-7-16-31/h3-13,15-22,25,35-37,41H,14,23-24,26-30H2,1-2H3/b21-12+/t35-,36+,37-,41+/m1/s1 |
| InChIKey | XWIFJKLQJKSJGX-GKLVSVHISA-N |
| XLogP | 8.73 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.81 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|