C36H52N2O9 — CID 159554582
[2,2-bis(5-oxohept-6-enoxymethyl)-3-[3-(prop-2-enoylamino)propoxy]propyl] 2-(4-aminobutanoyl)benzoate (PubChem CID 159554582) has the molecular formula C36H52N2O9 and a molecular weight of 656.82 g/mol. Its IUPAC name is [2,2-bis(5-oxohept-6-enoxymethyl)-3-[3-(prop-2-enoylamino)propoxy]propyl] 2-(4-aminobutanoyl)benzoate.
| Compound Name | [2,2-bis(5-oxohept-6-enoxymethyl)-3-[3-(prop-2-enoylamino)propoxy]propyl] 2-(4-aminobutanoyl)benzoate |
|---|---|
| PubChem CID | 159554582 |
| Molecular Formula | C36H52N2O9 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.37 |
| IUPAC Name | [2,2-bis(5-oxohept-6-enoxymethyl)-3-[3-(prop-2-enoylamino)propoxy]propyl] 2-(4-aminobutanoyl)benzoate |
| SMILES | C=CC(=O)CCCCOCC(COCCCCC(=O)C=C)(COCCCNC(=O)C=C)COC(=O)c1ccccc1C(=O)CCCN |
| InChI | InChI=1S/C36H52N2O9/c1-4-29(39)15-9-11-22-44-25-36(26-45-23-12-10-16-30(40)5-2,27-46-24-14-21-38-34(42)6-3)28-47-35(43)32-18-8-7-17-31(32)33(41)19-13-20-37/h4-8,17-18H,1-3,9-16,19-28,37H2,(H,38,42) |
| InChIKey | PSLWVTNBVYCNSQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|