C25H21F3O7 — CID 159555046
ethyl 2H-chromene-3-carboxylate;8-formyl-6-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 159555046) has the molecular formula C25H21F3O7 and a molecular weight of 490.43 g/mol. Its IUPAC name is ethyl 2H-chromene-3-carboxylate;8-formyl-6-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | ethyl 2H-chromene-3-carboxylate;8-formyl-6-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 159555046 |
| Molecular Formula | C25H21F3O7 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | ethyl 2H-chromene-3-carboxylate;8-formyl-6-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCOC(=O)C1=Cc2ccccc2OC1.Cc1cc(C=O)c2c(c1)C=C(C(=O)O)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C13H9F3O4.C12H12O3/c1-6-2-7-4-9(12(18)19)11(13(14,15)16)20-10(7)8(3-6)5-17;1-2-14-12(13)10-7-9-5-3-4-6-11(9)15-8-10/h2-5,11H,1H3,(H,18,19);3-7H,2,8H2,1H3 |
| InChIKey | MFWMYJPYWNMYPO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|