C11H8N2Se — CID 159563538
4-methyl-8-selena-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 159563538) has the molecular formula C11H8N2Se and a molecular weight of 247.16 g/mol. Its IUPAC name is 4-methyl-8-selena-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4-methyl-8-selena-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 159563538 |
| Molecular Formula | C11H8N2Se |
| Molecular Weight | 247.16 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 4-methyl-8-selena-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cc1ccc2[se]c3cccnc3c2n1 |
| InChI | InChI=1S/C11H8N2Se/c1-7-4-5-9-11(13-7)10-8(14-9)3-2-6-12-10/h2-6H,1H3 |
| InChIKey | FOZUWLAFLVQKCN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|