C17H9NOSe — CID 164814910
20-oxa-12-selena-7-azapentacyclo[15.2.1.05,19.06,11.013,18]icosa-1,3,5(19),6(11),7,9,13,15,17-nonaene (PubChem CID 164814910) has the molecular formula C17H9NOSe and a molecular weight of 322.23 g/mol. Its IUPAC name is 20-oxa-12-selena-7-azapentacyclo[15.2.1.05,19.06,11.013,18]icosa-1,3,5(19),6(11),7,9,13,15,17-nonaene.
| Compound Name | 20-oxa-12-selena-7-azapentacyclo[15.2.1.05,19.06,11.013,18]icosa-1,3,5(19),6(11),7,9,13,15,17-nonaene |
|---|---|
| PubChem CID | 164814910 |
| Molecular Formula | C17H9NOSe |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 20-oxa-12-selena-7-azapentacyclo[15.2.1.05,19.06,11.013,18]icosa-1,3,5(19),6(11),7,9,13,15,17-nonaene |
| SMILES | c1cnc2c(c1)[se]c1cccc3oc4cccc2c4c31 |
| InChI | InChI=1S/C17H9NOSe/c1-4-10-15-11(5-1)19-12-6-2-7-13(16(12)15)20-14-8-3-9-18-17(10)14/h1-9H |
| InChIKey | RUTWRFCNAHWSOF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|