C48H50B2O4 — CID 159566073
2-[7,12-bis(3,5-dimethylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[k]fluoranthen-9-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 159566073) has the molecular formula C48H50B2O4 and a molecular weight of 712.55 g/mol. Its IUPAC name is 2-[7,12-bis(3,5-dimethylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[k]fluoranthen-9-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[7,12-bis(3,5-dimethylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[k]fluoranthen-9-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 159566073 |
| Molecular Formula | C48H50B2O4 |
| Molecular Weight | 712.55 g/mol |
| Exact Mass | 712.39 |
| IUPAC Name | 2-[7,12-bis(3,5-dimethylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[k]fluoranthen-9-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1cc(C)cc(-c2c3c(c(-c4cc(C)cc(C)c4)c4cc(B5OC(C)(C)C(C)(C)O5)ccc24)-c2ccc(B4OC(C)(C)C(C)(C)O4)c4cccc-3c24)c1 |
| InChI | InChI=1S/C48H50B2O4/c1-27-20-28(2)23-31(22-27)40-34-17-16-33(49-51-45(5,6)46(7,8)52-49)26-38(34)41(32-24-29(3)21-30(4)25-32)44-37-18-19-39(50-53-47(9,10)48(11,12)54-50)35-14-13-15-36(42(35)37)43(40)44/h13-26H,1-12H3 |
| InChIKey | YFBWHSABFLMDOT-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.55 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|