About dicyclohexylazanium;N,N-dicyclohexylcarbamodithioate
dicyclohexylazanium;N,N-dicyclohexylcarbamodithioate (PubChem CID 159574722) has the molecular formula C25H46N2S2
and a molecular weight of 438.79 g/mol. Its IUPAC name is dicyclohexylazanium;N,N-dicyclohexylcarbamodithioate.
Molecular Properties
| Compound Name | dicyclohexylazanium;N,N-dicyclohexylcarbamodithioate |
| PubChem CID | 159574722 |
| Molecular Formula | C25H46N2S2 |
| Molecular Weight | 438.79 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | dicyclohexylazanium;N,N-dicyclohexylcarbamodithioate |
| SMILES | C1CCC([NH2+]C2CCCCC2)CC1.S=C([S-])N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C13H23NS2.C12H23N/c15-13(16)14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h11-12H,1-10H2,(H,15,16);11-13H,1-10H2 |
| InChIKey | MIGIJJNTKWKQNX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 19.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.79 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexylazanium;N,N-dicyclohexylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexylazanium;N,N-dicyclohexylcarbamodithioate?
The IUPAC name of dicyclohexylazanium;N,N-dicyclohexylcarbamodithioate (CID 159574722) is dicyclohexylazanium;N,N-dicyclohexylcarbamodithioate.
What is the SMILES notation for dicyclohexylazanium;N,N-dicyclohexylcarbamodithioate?
The canonical SMILES for dicyclohexylazanium;N,N-dicyclohexylcarbamodithioate is C1CCC([NH2+]C2CCCCC2)CC1.S=C([S-])N(C1CCCCC1)C1CCCCC1.
What is the InChIKey of dicyclohexylazanium;N,N-dicyclohexylcarbamodithioate?
The InChIKey is MIGIJJNTKWKQNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NS2.C12H23N/c15-13(16)14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h11-12H,1-10H2,(H,15,16);11-13H,1-10H2.
What are the key properties of dicyclohexylazanium;N,N-dicyclohexylcarbamodithioate?
dicyclohexylazanium;N,N-dicyclohexylcarbamodithioate has a molecular weight of 438.79 g/mol, XLogP of 6.00, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexylazanium;N,N-dicyclohexylcarbamodithioate is sourced from PubChem (CID 159574722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).