C25H46N2O8Si2 — CID 15958329
2-[3-[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-ethyl-2,6-dioxopyrimidin-1-yl]acetic acid (PubChem CID 15958329) has the molecular formula C25H46N2O8Si2 and a molecular weight of 558.82 g/mol. Its IUPAC name is 2-[3-[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-ethyl-2,6-dioxopyrimidin-1-yl]acetic acid.
| Compound Name | 2-[3-[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-ethyl-2,6-dioxopyrimidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 15958329 |
| Molecular Formula | C25H46N2O8Si2 |
| Molecular Weight | 558.82 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | 2-[3-[(2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-ethyl-2,6-dioxopyrimidin-1-yl]acetic acid |
| SMILES | CCc1cn([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)c(=O)n(CC(=O)O)c1=O |
| InChI | InChI=1S/C25H46N2O8Si2/c1-12-16-13-27(23(32)26(21(16)31)14-18(28)29)22-20(35-37(10,11)25(5,6)7)19(30)17(34-22)15-33-36(8,9)24(2,3)4/h13,17,19-20,22,30H,12,14-15H2,1-11H3,(H,28,29)/t17-,19-,20-,22-/m1/s1 |
| InChIKey | IBROXRXBKLZNJH-JWUVWSEFSA-N |
| XLogP | 3.33 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|