C16H10Cl2O2 — CID 15959103
(3Z)-3-[(3,4-dichlorophenyl)methylidene]-5-methyl-2-benzofuran-1-one (PubChem CID 15959103) has the molecular formula C16H10Cl2O2 and a molecular weight of 305.16 g/mol. Its IUPAC name is (3Z)-3-[(3,4-dichlorophenyl)methylidene]-5-methyl-2-benzofuran-1-one.
| Compound Name | (3Z)-3-[(3,4-dichlorophenyl)methylidene]-5-methyl-2-benzofuran-1-one |
|---|---|
| PubChem CID | 15959103 |
| Molecular Formula | C16H10Cl2O2 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | (3Z)-3-[(3,4-dichlorophenyl)methylidene]-5-methyl-2-benzofuran-1-one |
| SMILES | Cc1ccc2c(c1)/C(=C/c1ccc(Cl)c(Cl)c1)OC2=O |
| InChI | InChI=1S/C16H10Cl2O2/c1-9-2-4-11-12(6-9)15(20-16(11)19)8-10-3-5-13(17)14(18)7-10/h2-8H,1H3/b15-8- |
| InChIKey | MUWUZTHECLKUHC-NVNXTCNLSA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|