C28H26F3N3O9 — CID 15959330
5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)aniline (PubChem CID 15959330) has the molecular formula C28H26F3N3O9 and a molecular weight of 605.52 g/mol. Its IUPAC name is 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)aniline.
| Compound Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 15959330 |
| Molecular Formula | C28H26F3N3O9 |
| Molecular Weight | 605.52 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one;2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)aniline |
| SMILES | CCCN(CCC)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-].O=c1c(-c2ccc(O)cc2)coc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O5.C13H16F3N3O4/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19;1-3-5-17(6-4-2)12-10(18(20)21)7-9(13(14,15)16)8-11(12)19(22)23/h1-7,16-18H;7-8H,3-6H2,1-2H3 |
| InChIKey | HFMRSNGAMNZYQF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 180.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|