C44H39FN6O8 — CID 159601266
4-anilino-6-[4-[[7-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-6-oxoheptyl]carbamoyl]-3-fluorophenyl]-N-methylquinoline-3-carboxamide (PubChem CID 159601266) has the molecular formula C44H39FN6O8 and a molecular weight of 798.83 g/mol. Its IUPAC name is 4-anilino-6-[4-[[7-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-6-oxoheptyl]carbamoyl]-3-fluorophenyl]-N-methylquinoline-3-carboxamide.
| Compound Name | 4-anilino-6-[4-[[7-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-6-oxoheptyl]carbamoyl]-3-fluorophenyl]-N-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 159601266 |
| Molecular Formula | C44H39FN6O8 |
| Molecular Weight | 798.83 g/mol |
| Exact Mass | 798.28 |
| IUPAC Name | 4-anilino-6-[4-[[7-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxy-6-oxoheptyl]carbamoyl]-3-fluorophenyl]-N-methylquinoline-3-carboxamide |
| SMILES | CNC(=O)c1cnc2ccc(-c3ccc(C(=O)NCCCCCC(=O)COc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)c(F)c3)cc2c1Nc1ccccc1 |
| InChI | InChI=1S/C44H39FN6O8/c1-46-40(54)32-23-48-34-17-15-25(21-31(34)39(32)49-27-9-4-2-5-10-27)26-14-16-29(33(45)22-26)41(55)47-20-7-3-6-11-28(52)24-59-36-13-8-12-30-38(36)44(58)51(43(30)57)35-18-19-37(53)50-42(35)56/h2,4-5,8-10,12-17,21-23,35H,3,6-7,11,18-20,24H2,1H3,(H,46,54)(H,47,55)(H,48,49)(H,50,53,56) |
| InChIKey | RTXOWJZFOXEJHZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 192.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.83 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|