C62H106O7P2 — CID 159604140
1,4-ditert-butyl-2,5-bis(2,6-ditert-butylphenoxy)-3,6-bis(8-methylnonyl)benzene;dihydroxyphosphanyl dihydrogen phosphite (PubChem CID 159604140) has the molecular formula C62H106O7P2 and a molecular weight of 1025.47 g/mol. Its IUPAC name is 1,4-ditert-butyl-2,5-bis(2,6-ditert-butylphenoxy)-3,6-bis(8-methylnonyl)benzene;dihydroxyphosphanyl dihydrogen phosphite.
| Compound Name | 1,4-ditert-butyl-2,5-bis(2,6-ditert-butylphenoxy)-3,6-bis(8-methylnonyl)benzene;dihydroxyphosphanyl dihydrogen phosphite |
|---|---|
| PubChem CID | 159604140 |
| Molecular Formula | C62H106O7P2 |
| Molecular Weight | 1025.47 g/mol |
| Exact Mass | 1024.74 |
| IUPAC Name | 1,4-ditert-butyl-2,5-bis(2,6-ditert-butylphenoxy)-3,6-bis(8-methylnonyl)benzene;dihydroxyphosphanyl dihydrogen phosphite |
| SMILES | CC(C)CCCCCCCc1c(Oc2c(C(C)(C)C)cccc2C(C)(C)C)c(C(C)(C)C)c(CCCCCCCC(C)C)c(Oc2c(C(C)(C)C)cccc2C(C)(C)C)c1C(C)(C)C.OP(O)OP(O)O |
| InChI | InChI=1S/C62H102O2.H4O5P2/c1-43(2)35-29-25-23-27-31-37-45-51(61(17,18)19)54(64-56-49(59(11,12)13)41-34-42-50(56)60(14,15)16)46(38-32-28-24-26-30-36-44(3)4)52(62(20,21)22)53(45)63-55-47(57(5,6)7)39-33-40-48(55)58(8,9)10;1-6(2)5-7(3)4/h33-34,39-44H,23-32,35-38H2,1-22H3;1-4H |
| InChIKey | MLVZGEOLUOZPDF-UHFFFAOYSA-N |
| XLogP | 19.56 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.47 |
| LogP ≤ 5 | 19.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|