C50H86O2 — CID 88774454
2-(2,4-ditert-butylphenyl)-3,5,6-tris(8-methylnonyl)benzene-1,4-diol (PubChem CID 88774454) has the molecular formula C50H86O2 and a molecular weight of 719.24 g/mol. Its IUPAC name is 2-(2,4-ditert-butylphenyl)-3,5,6-tris(8-methylnonyl)benzene-1,4-diol.
| Compound Name | 2-(2,4-ditert-butylphenyl)-3,5,6-tris(8-methylnonyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 88774454 |
| Molecular Formula | C50H86O2 |
| Molecular Weight | 719.24 g/mol |
| Exact Mass | 718.66 |
| IUPAC Name | 2-(2,4-ditert-butylphenyl)-3,5,6-tris(8-methylnonyl)benzene-1,4-diol |
| SMILES | CC(C)CCCCCCCc1c(O)c(CCCCCCCC(C)C)c(-c2ccc(C(C)(C)C)cc2C(C)(C)C)c(O)c1CCCCCCCC(C)C |
| InChI | InChI=1S/C50H86O2/c1-37(2)28-22-16-13-19-25-31-41-42(32-26-20-14-17-23-29-38(3)4)48(52)46(44(47(41)51)33-27-21-15-18-24-30-39(5)6)43-35-34-40(49(7,8)9)36-45(43)50(10,11)12/h34-39,51-52H,13-33H2,1-12H3 |
| InChIKey | LALJGZKCHRMRLH-UHFFFAOYSA-N |
| XLogP | 15.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.24 |
| LogP ≤ 5 | 15.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|