C20H24N2O3S2 — CID 159658715
N-[[4-[(3,4-dimethylphenyl)methylsulfonyl]phenyl]carbamothioyl]-2-methylpropanamide (PubChem CID 159658715) has the molecular formula C20H24N2O3S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is N-[[4-[(3,4-dimethylphenyl)methylsulfonyl]phenyl]carbamothioyl]-2-methylpropanamide.
| Compound Name | N-[[4-[(3,4-dimethylphenyl)methylsulfonyl]phenyl]carbamothioyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 159658715 |
| Molecular Formula | C20H24N2O3S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | N-[[4-[(3,4-dimethylphenyl)methylsulfonyl]phenyl]carbamothioyl]-2-methylpropanamide |
| SMILES | Cc1ccc(CS(=O)(=O)c2ccc(NC(=S)NC(=O)C(C)C)cc2)cc1C |
| InChI | InChI=1S/C20H24N2O3S2/c1-13(2)19(23)22-20(26)21-17-7-9-18(10-8-17)27(24,25)12-16-6-5-14(3)15(4)11-16/h5-11,13H,12H2,1-4H3,(H2,21,22,23,26) |
| InChIKey | MSMYDWQNUYDDGM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|