C9H11NO4S — CID 159659034
2,3-dihydroinden-1-one;sulfamic acid (PubChem CID 159659034) has the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. Its IUPAC name is 2,3-dihydroinden-1-one;sulfamic acid.
| Compound Name | 2,3-dihydroinden-1-one;sulfamic acid |
|---|---|
| PubChem CID | 159659034 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 2,3-dihydroinden-1-one;sulfamic acid |
| SMILES | NS(=O)(=O)O.O=C1CCc2ccccc21 |
| InChI | InChI=1S/C9H8O.H3NO3S/c10-9-6-5-7-3-1-2-4-8(7)9;1-5(2,3)4/h1-4H,5-6H2;(H3,1,2,3,4) |
| InChIKey | MSOBWCSFARDKKQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|