2,3-dihydroinden-1-one;sulfamic acid

C9H11NO4S — CID 159659034

IUPAC2,3-dihydroinden-1-one;sulfamic acid
SMILESNS(=O)(=O)O.O=C1CCc2ccccc21
InChIInChI=1S/C9H8O.H3NO3S/c10-9-6-5-7-3-1-2-4-8(7)9;1-5(2,3)4/h1-4H,5-6H2;(H3,1,2,3,4)
InChIKeyMSOBWCSFARDKKQ-UHFFFAOYSA-N
MW229.26 g/mol
LogP0.56
Rot. Bonds

About 2,3-dihydroinden-1-one;sulfamic acid

2,3-dihydroinden-1-one;sulfamic acid (PubChem CID 159659034) has the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. Its IUPAC name is 2,3-dihydroinden-1-one;sulfamic acid.

Molecular Properties

Compound Name2,3-dihydroinden-1-one;sulfamic acid
PubChem CID159659034
Molecular FormulaC9H11NO4S
Molecular Weight229.26 g/mol
Exact Mass229.04
IUPAC Name2,3-dihydroinden-1-one;sulfamic acid
SMILESNS(=O)(=O)O.O=C1CCc2ccccc21
InChIInChI=1S/C9H8O.H3NO3S/c10-9-6-5-7-3-1-2-4-8(7)9;1-5(2,3)4/h1-4H,5-6H2;(H3,1,2,3,4)
InChIKeyMSOBWCSFARDKKQ-UHFFFAOYSA-N
XLogP0.56
TPSA97.46 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.26
LogP ≤ 50.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,3-dihydroinden-1-one;sulfamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydroinden-1-one;sulfamic acid?
The IUPAC name of 2,3-dihydroinden-1-one;sulfamic acid (CID 159659034) is 2,3-dihydroinden-1-one;sulfamic acid.
What is the SMILES notation for 2,3-dihydroinden-1-one;sulfamic acid?
The canonical SMILES for 2,3-dihydroinden-1-one;sulfamic acid is NS(=O)(=O)O.O=C1CCc2ccccc21.
What is the InChIKey of 2,3-dihydroinden-1-one;sulfamic acid?
The InChIKey is MSOBWCSFARDKKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.H3NO3S/c10-9-6-5-7-3-1-2-4-8(7)9;1-5(2,3)4/h1-4H,5-6H2;(H3,1,2,3,4).
What are the key properties of 2,3-dihydroinden-1-one;sulfamic acid?
2,3-dihydroinden-1-one;sulfamic acid has a molecular weight of 229.26 g/mol, XLogP of 0.56, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroinden-1-one;sulfamic acid is sourced from PubChem (CID 159659034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).