C11H16O5 — CID 15966282
(1S,3S,5S,8R,9R,11R)-5-methoxy-3-methyl-2,6,12-trioxatetracyclo[6.4.0.03,11.05,9]dodecan-11-ol (PubChem CID 15966282) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is (1S,3S,5S,8R,9R,11R)-5-methoxy-3-methyl-2,6,12-trioxatetracyclo[6.4.0.03,11.05,9]dodecan-11-ol.
| Compound Name | (1S,3S,5S,8R,9R,11R)-5-methoxy-3-methyl-2,6,12-trioxatetracyclo[6.4.0.03,11.05,9]dodecan-11-ol |
|---|---|
| PubChem CID | 15966282 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (1S,3S,5S,8R,9R,11R)-5-methoxy-3-methyl-2,6,12-trioxatetracyclo[6.4.0.03,11.05,9]dodecan-11-ol |
| SMILES | CO[C@]12C[C@]3(C)O[C@H]4O[C@]3(O)C[C@@H]1[C@@H]4CO2 |
| InChI | InChI=1S/C11H16O5/c1-9-5-10(13-2)7-3-11(9,12)16-8(15-9)6(7)4-14-10/h6-8,12H,3-5H2,1-2H3/t6-,7+,8-,9-,10-,11+/m0/s1 |
| InChIKey | KCAAGBCFVTYDEV-HQPKYVJOSA-N |
| XLogP | 0.22 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |