C16H24N4O4 — CID 159668176
1-(4,5-dimethyl-2-nitrophenyl)ethyl N-[bis(dimethylamino)methylidene]carbamate (PubChem CID 159668176) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-[bis(dimethylamino)methylidene]carbamate.
| Compound Name | 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-[bis(dimethylamino)methylidene]carbamate |
|---|---|
| PubChem CID | 159668176 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-(4,5-dimethyl-2-nitrophenyl)ethyl N-[bis(dimethylamino)methylidene]carbamate |
| SMILES | Cc1cc(C(C)OC(=O)N=C(N(C)C)N(C)C)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C16H24N4O4/c1-10-8-13(14(20(22)23)9-11(10)2)12(3)24-16(21)17-15(18(4)5)19(6)7/h8-9,12H,1-7H3 |
| InChIKey | XMPYIPXCXINEQQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|