C26H26Cl2N4O2 — CID 159673896
8-butyl-3-(3-chlorophenyl)-5-[(4-chlorophenyl)methyl]-1,4,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione (PubChem CID 159673896) has the molecular formula C26H26Cl2N4O2 and a molecular weight of 497.43 g/mol. Its IUPAC name is 8-butyl-3-(3-chlorophenyl)-5-[(4-chlorophenyl)methyl]-1,4,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione.
| Compound Name | 8-butyl-3-(3-chlorophenyl)-5-[(4-chlorophenyl)methyl]-1,4,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione |
|---|---|
| PubChem CID | 159673896 |
| Molecular Formula | C26H26Cl2N4O2 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 8-butyl-3-(3-chlorophenyl)-5-[(4-chlorophenyl)methyl]-1,4,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione |
| SMILES | CCCCN1C(=O)c2c(c(-c3cccc(Cl)c3)nn2Cc2ccc(Cl)cc2)N2CCCC2C1=O |
| InChI | InChI=1S/C26H26Cl2N4O2/c1-2-3-13-31-25(33)21-8-5-14-30(21)23-22(18-6-4-7-20(28)15-18)29-32(24(23)26(31)34)16-17-9-11-19(27)12-10-17/h4,6-7,9-12,15,21H,2-3,5,8,13-14,16H2,1H3 |
| InChIKey | KZWDDGDXHPBAQP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|