C27H26ClF3N4O4 — CID 158945647
(10S)-8-butyl-5-[(4-chlorophenyl)methyl]-4-[3-(trifluoromethoxy)phenoxy]-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione (PubChem CID 158945647) has the molecular formula C27H26ClF3N4O4 and a molecular weight of 562.98 g/mol. Its IUPAC name is (10S)-8-butyl-5-[(4-chlorophenyl)methyl]-4-[3-(trifluoromethoxy)phenoxy]-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione.
| Compound Name | (10S)-8-butyl-5-[(4-chlorophenyl)methyl]-4-[3-(trifluoromethoxy)phenoxy]-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione |
|---|---|
| PubChem CID | 158945647 |
| Molecular Formula | C27H26ClF3N4O4 |
| Molecular Weight | 562.98 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | (10S)-8-butyl-5-[(4-chlorophenyl)methyl]-4-[3-(trifluoromethoxy)phenoxy]-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione |
| SMILES | CCCCN1C(=O)c2c(nc(Oc3cccc(OC(F)(F)F)c3)n2Cc2ccc(Cl)cc2)N2CCC[C@H]2C1=O |
| InChI | InChI=1S/C27H26ClF3N4O4/c1-2-3-13-34-24(36)21-8-5-14-33(21)23-22(25(34)37)35(16-17-9-11-18(28)12-10-17)26(32-23)38-19-6-4-7-20(15-19)39-27(29,30)31/h4,6-7,9-12,15,21H,2-3,5,8,13-14,16H2,1H3/t21-/m0/s1 |
| InChIKey | GVWAPQXOPKMQCU-NRFANRHFSA-N |
| XLogP | 6.03 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.98 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|