C25H28ClN5O3 — CID 159673898
8-butyl-5-[(4-chlorophenyl)methyl]-4-(furan-2-ylmethylamino)-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione (PubChem CID 159673898) has the molecular formula C25H28ClN5O3 and a molecular weight of 481.98 g/mol. Its IUPAC name is 8-butyl-5-[(4-chlorophenyl)methyl]-4-(furan-2-ylmethylamino)-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione.
| Compound Name | 8-butyl-5-[(4-chlorophenyl)methyl]-4-(furan-2-ylmethylamino)-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione |
|---|---|
| PubChem CID | 159673898 |
| Molecular Formula | C25H28ClN5O3 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 8-butyl-5-[(4-chlorophenyl)methyl]-4-(furan-2-ylmethylamino)-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione |
| SMILES | CCCCN1C(=O)c2c(nc(NCc3ccco3)n2Cc2ccc(Cl)cc2)N2CCCC2C1=O |
| InChI | InChI=1S/C25H28ClN5O3/c1-2-3-12-30-23(32)20-7-4-13-29(20)22-21(24(30)33)31(16-17-8-10-18(26)11-9-17)25(28-22)27-15-19-6-5-14-34-19/h5-6,8-11,14,20H,2-4,7,12-13,15-16H2,1H3,(H,27,28) |
| InChIKey | BZQLFSZZQGQSQR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|