C23H29ClN4O3 — CID 159673894
8-butyl-5-[(4-chlorophenyl)methyl]-4-propoxy-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione (PubChem CID 159673894) has the molecular formula C23H29ClN4O3 and a molecular weight of 444.96 g/mol. Its IUPAC name is 8-butyl-5-[(4-chlorophenyl)methyl]-4-propoxy-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione.
| Compound Name | 8-butyl-5-[(4-chlorophenyl)methyl]-4-propoxy-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione |
|---|---|
| PubChem CID | 159673894 |
| Molecular Formula | C23H29ClN4O3 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 8-butyl-5-[(4-chlorophenyl)methyl]-4-propoxy-1,3,5,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),3-diene-7,9-dione |
| SMILES | CCCCN1C(=O)c2c(nc(OCCC)n2Cc2ccc(Cl)cc2)N2CCCC2C1=O |
| InChI | InChI=1S/C23H29ClN4O3/c1-3-5-12-27-21(29)18-7-6-13-26(18)20-19(22(27)30)28(23(25-20)31-14-4-2)15-16-8-10-17(24)11-9-16/h8-11,18H,3-7,12-15H2,1-2H3 |
| InChIKey | IMIPQYCRFZZMKB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|