C20H27ClN4O4 — CID 139452274
8-butoxy-7-[(4-chlorophenyl)methyl]-2-hydroxy-1-(3-hydroxypropyl)-3-methyl-2H-purin-6-one (PubChem CID 139452274) has the molecular formula C20H27ClN4O4 and a molecular weight of 422.91 g/mol. Its IUPAC name is 8-butoxy-7-[(4-chlorophenyl)methyl]-2-hydroxy-1-(3-hydroxypropyl)-3-methyl-2H-purin-6-one.
| Compound Name | 8-butoxy-7-[(4-chlorophenyl)methyl]-2-hydroxy-1-(3-hydroxypropyl)-3-methyl-2H-purin-6-one |
|---|---|
| PubChem CID | 139452274 |
| Molecular Formula | C20H27ClN4O4 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 8-butoxy-7-[(4-chlorophenyl)methyl]-2-hydroxy-1-(3-hydroxypropyl)-3-methyl-2H-purin-6-one |
| SMILES | CCCCOc1nc2c(n1Cc1ccc(Cl)cc1)C(=O)N(CCCO)C(O)N2C |
| InChI | InChI=1S/C20H27ClN4O4/c1-3-4-12-29-19-22-17-16(25(19)13-14-6-8-15(21)9-7-14)18(27)24(10-5-11-26)20(28)23(17)2/h6-9,20,26,28H,3-5,10-13H2,1-2H3 |
| InChIKey | GCEGUHZZBSVIQN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|