C18H43N7O2 — CID 159694374
3-amino-2-(deuterioamino)-N-ethylpropanamide;2-(3-aminopropylamino)-4-(butylamino)-N-ethylbutanamide (PubChem CID 159694374) has the molecular formula C18H43N7O2 and a molecular weight of 390.60 g/mol. Its IUPAC name is 3-amino-2-(deuterioamino)-N-ethylpropanamide;2-(3-aminopropylamino)-4-(butylamino)-N-ethylbutanamide.
| Compound Name | 3-amino-2-(deuterioamino)-N-ethylpropanamide;2-(3-aminopropylamino)-4-(butylamino)-N-ethylbutanamide |
|---|---|
| PubChem CID | 159694374 |
| Molecular Formula | C18H43N7O2 |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.35 |
| IUPAC Name | 3-amino-2-(deuterioamino)-N-ethylpropanamide;2-(3-aminopropylamino)-4-(butylamino)-N-ethylbutanamide |
| SMILES | CCCCNCCC(NCCCN)C(=O)NCC.[2H]NC(CN)C(=O)NCC |
| InChI | InChI=1S/C13H30N4O.C5H13N3O/c1-3-5-9-15-11-7-12(13(18)16-4-2)17-10-6-8-14;1-2-8-5(9)4(7)3-6/h12,15,17H,3-11,14H2,1-2H3,(H,16,18);4H,2-3,6-7H2,1H3,(H,8,9)/i/hD |
| InChIKey | MWVAMUFNXMWXEK-DYCDLGHISA-N |
| XLogP | -1.38 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|