C15H34N6O2S — CID 88877300
N-[2-(2-amino-2-oxoethyl)sulfanylethyl]-2,5-bis(3-aminopropylamino)pentanamide (PubChem CID 88877300) has the molecular formula C15H34N6O2S and a molecular weight of 362.54 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethyl)sulfanylethyl]-2,5-bis(3-aminopropylamino)pentanamide.
| Compound Name | N-[2-(2-amino-2-oxoethyl)sulfanylethyl]-2,5-bis(3-aminopropylamino)pentanamide |
|---|---|
| PubChem CID | 88877300 |
| Molecular Formula | C15H34N6O2S |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | N-[2-(2-amino-2-oxoethyl)sulfanylethyl]-2,5-bis(3-aminopropylamino)pentanamide |
| SMILES | NCCCNCCCC(NCCCN)C(=O)NCCSCC(N)=O |
| InChI | InChI=1S/C15H34N6O2S/c16-5-2-8-19-7-1-4-13(20-9-3-6-17)15(23)21-10-11-24-12-14(18)22/h13,19-20H,1-12,16-17H2,(H2,18,22)(H,21,23) |
| InChIKey | AMKDRRXWLFOTJS-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 148.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|