C15H35N5OS — CID 88877319
2,5-bis(3-aminopropylamino)-N-(2-ethylsulfanylethyl)pentanamide (PubChem CID 88877319) has the molecular formula C15H35N5OS and a molecular weight of 333.55 g/mol. Its IUPAC name is 2,5-bis(3-aminopropylamino)-N-(2-ethylsulfanylethyl)pentanamide.
| Compound Name | 2,5-bis(3-aminopropylamino)-N-(2-ethylsulfanylethyl)pentanamide |
|---|---|
| PubChem CID | 88877319 |
| Molecular Formula | C15H35N5OS |
| Molecular Weight | 333.55 g/mol |
| Exact Mass | 333.26 |
| IUPAC Name | 2,5-bis(3-aminopropylamino)-N-(2-ethylsulfanylethyl)pentanamide |
| SMILES | CCSCCNC(=O)C(CCCNCCCN)NCCCN |
| InChI | InChI=1S/C15H35N5OS/c1-2-22-13-12-20-15(21)14(19-11-5-8-17)6-3-9-18-10-4-7-16/h14,18-19H,2-13,16-17H2,1H3,(H,20,21) |
| InChIKey | UAMTYZQATDCZSJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.55 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|