C24H54N8O2 — CID 169489086
1,4,9,12-tetrakis(3-aminopropylamino)dodecane-5,8-dione (PubChem CID 169489086) has the molecular formula C24H54N8O2 and a molecular weight of 486.75 g/mol. Its IUPAC name is 1,4,9,12-tetrakis(3-aminopropylamino)dodecane-5,8-dione.
| Compound Name | 1,4,9,12-tetrakis(3-aminopropylamino)dodecane-5,8-dione |
|---|---|
| PubChem CID | 169489086 |
| Molecular Formula | C24H54N8O2 |
| Molecular Weight | 486.75 g/mol |
| Exact Mass | 486.44 |
| IUPAC Name | 1,4,9,12-tetrakis(3-aminopropylamino)dodecane-5,8-dione |
| SMILES | NCCCNCCCC(NCCCN)C(=O)CCC(=O)C(CCCNCCCN)NCCCN |
| InChI | InChI=1S/C24H54N8O2/c25-11-3-17-29-15-1-7-21(31-19-5-13-27)23(33)9-10-24(34)22(32-20-6-14-28)8-2-16-30-18-4-12-26/h21-22,29-32H,1-20,25-28H2 |
| InChIKey | FUPTXAHQTZUTQO-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 186.34 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.75 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|