C64H79N5 — CID 159695474
4-[2-[10-(2-ethylhexyl)-20-heptan-3-yl-15-[2-(4-methylphenyl)ethynyl]-21,24-dihydroporphyrin-5-yl]ethynyl]-N,N-dihexylaniline (PubChem CID 159695474) has the molecular formula C64H79N5 and a molecular weight of 918.37 g/mol. Its IUPAC name is 4-[2-[10-(2-ethylhexyl)-20-heptan-3-yl-15-[2-(4-methylphenyl)ethynyl]-21,24-dihydroporphyrin-5-yl]ethynyl]-N,N-dihexylaniline.
| Compound Name | 4-[2-[10-(2-ethylhexyl)-20-heptan-3-yl-15-[2-(4-methylphenyl)ethynyl]-21,24-dihydroporphyrin-5-yl]ethynyl]-N,N-dihexylaniline |
|---|---|
| PubChem CID | 159695474 |
| Molecular Formula | C64H79N5 |
| Molecular Weight | 918.37 g/mol |
| Exact Mass | 917.63 |
| IUPAC Name | 4-[2-[10-(2-ethylhexyl)-20-heptan-3-yl-15-[2-(4-methylphenyl)ethynyl]-21,24-dihydroporphyrin-5-yl]ethynyl]-N,N-dihexylaniline |
| SMILES | CCCCCCN(CCCCCC)c1ccc(C#Cc2c3nc(c(CC(CC)CCCC)c4nc(c(C#Cc5ccc(C)cc5)c5ccc([nH]5)c(C(CC)CCCC)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C64H79N5/c1-8-14-18-20-44-69(45-21-19-15-9-2)52-32-28-50(29-33-52)31-35-54-57-37-39-61(66-57)55(46-48(12-5)22-16-10-3)60-38-36-56(65-60)53(34-30-49-26-24-47(7)25-27-49)58-40-42-62(67-58)64(51(13-6)23-17-11-4)63-43-41-59(54)68-63/h24-29,32-33,36-43,48,51,67-68H,8-23,44-46H2,1-7H3/b56-53-,57-54-,58-53-,59-54-,60-55-,61-55-,64-62-,64-63- |
| InChIKey | ISSUAYCCLOQUPS-MJCSSBJGSA-N |
| XLogP | 17.17 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.37 |
| LogP ≤ 5 | 17.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|