C35H22I2N2O4 — CID 159726863
3-[[12-[(2,3-dihydroxyphenyl)methylideneamino]-6,18-diiodo-12-pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3(8),4,6,9,14,16(21),17,19-decaenyl]iminomethyl]benzene-1,2-diol (PubChem CID 159726863) has the molecular formula C35H22I2N2O4 and a molecular weight of 788.38 g/mol. Its IUPAC name is 3-[[12-[(2,3-dihydroxyphenyl)methylideneamino]-6,18-diiodo-12-pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3(8),4,6,9,14,16(21),17,19-decaenyl]iminomethyl]benzene-1,2-diol.
| Compound Name | 3-[[12-[(2,3-dihydroxyphenyl)methylideneamino]-6,18-diiodo-12-pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3(8),4,6,9,14,16(21),17,19-decaenyl]iminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 159726863 |
| Molecular Formula | C35H22I2N2O4 |
| Molecular Weight | 788.38 g/mol |
| Exact Mass | 787.97 |
| IUPAC Name | 3-[[12-[(2,3-dihydroxyphenyl)methylideneamino]-6,18-diiodo-12-pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3(8),4,6,9,14,16(21),17,19-decaenyl]iminomethyl]benzene-1,2-diol |
| SMILES | Oc1cccc(C=NC2(N=Cc3cccc(O)c3O)c3ccc4cc(I)ccc4c3-c3c2ccc2cc(I)ccc32)c1O |
| InChI | InChI=1S/C35H22I2N2O4/c36-23-9-11-25-19(15-23)7-13-27-31(25)32-26-12-10-24(37)16-20(26)8-14-28(32)35(27,38-17-21-3-1-5-29(40)33(21)42)39-18-22-4-2-6-30(41)34(22)43/h1-18,40-43H |
| InChIKey | KZWYBNBKFCZLCJ-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.38 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|